C17H28O2 — CID 10849244
[(1R)-3-methylcyclohex-2-en-1-yl] (3R)-3,7-dimethyloct-6-enoate (PubChem CID 10849244) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is [(1R)-3-methylcyclohex-2-en-1-yl] (3R)-3,7-dimethyloct-6-enoate.
| Compound Name | [(1R)-3-methylcyclohex-2-en-1-yl] (3R)-3,7-dimethyloct-6-enoate |
|---|---|
| PubChem CID | 10849244 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | [(1R)-3-methylcyclohex-2-en-1-yl] (3R)-3,7-dimethyloct-6-enoate |
| SMILES | CC(C)=CCC[C@@H](C)CC(=O)O[C@H]1C=C(C)CCC1 |
| InChI | InChI=1S/C17H28O2/c1-13(2)7-5-8-15(4)12-17(18)19-16-10-6-9-14(3)11-16/h7,11,15-16H,5-6,8-10,12H2,1-4H3/t15-,16-/m1/s1 |
| InChIKey | BXVSMYLDTHKMIF-HZPDHXFCSA-N |
| XLogP | 4.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|