C21H36O — CID 23426652
(1S,4R,4aR,8aR)-4-methoxy-4,7-dimethyl-1-[(2R)-6-methylhept-5-en-2-yl]-2,3,4a,5,6,8a-hexahydro-1H-naphthalene (PubChem CID 23426652) has the molecular formula C21H36O and a molecular weight of 304.52 g/mol. Its IUPAC name is (1S,4R,4aR,8aR)-4-methoxy-4,7-dimethyl-1-[(2R)-6-methylhept-5-en-2-yl]-2,3,4a,5,6,8a-hexahydro-1H-naphthalene.
| Compound Name | (1S,4R,4aR,8aR)-4-methoxy-4,7-dimethyl-1-[(2R)-6-methylhept-5-en-2-yl]-2,3,4a,5,6,8a-hexahydro-1H-naphthalene |
|---|---|
| PubChem CID | 23426652 |
| Molecular Formula | C21H36O |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.28 |
| IUPAC Name | (1S,4R,4aR,8aR)-4-methoxy-4,7-dimethyl-1-[(2R)-6-methylhept-5-en-2-yl]-2,3,4a,5,6,8a-hexahydro-1H-naphthalene |
| SMILES | CO[C@]1(C)CC[C@@H]([C@H](C)CCC=C(C)C)[C@@H]2C=C(C)CC[C@H]21 |
| InChI | InChI=1S/C21H36O/c1-15(2)8-7-9-17(4)18-12-13-21(5,22-6)20-11-10-16(3)14-19(18)20/h8,14,17-20H,7,9-13H2,1-6H3/t17-,18+,19+,20-,21-/m1/s1 |
| InChIKey | FYMYVSWZQJBFNS-XDWAVFMPSA-N |
| XLogP | 6.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|