C20H32O — CID 171120076
(1R,2S,6R,10S)-3,7-dimethyl-10-(6-methylhept-5-en-2-yl)-11-oxatricyclo[5.3.1.02,6]undec-3-ene (PubChem CID 171120076) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is (1R,2S,6R,10S)-3,7-dimethyl-10-(6-methylhept-5-en-2-yl)-11-oxatricyclo[5.3.1.02,6]undec-3-ene.
| Compound Name | (1R,2S,6R,10S)-3,7-dimethyl-10-(6-methylhept-5-en-2-yl)-11-oxatricyclo[5.3.1.02,6]undec-3-ene |
|---|---|
| PubChem CID | 171120076 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | (1R,2S,6R,10S)-3,7-dimethyl-10-(6-methylhept-5-en-2-yl)-11-oxatricyclo[5.3.1.02,6]undec-3-ene |
| SMILES | CC(C)=CCCC(C)[C@@H]1CCC2(C)O[C@H]1[C@@H]1C(C)=CC[C@H]12 |
| InChI | InChI=1S/C20H32O/c1-13(2)7-6-8-14(3)16-11-12-20(5)17-10-9-15(4)18(17)19(16)21-20/h7,9,14,16-19H,6,8,10-12H2,1-5H3/t14?,16-,17+,18+,19+,20?/m0/s1 |
| InChIKey | ZVISKBJODPRNQM-DXYPSVLWSA-N |
| XLogP | 5.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|