C21H34O — CID 22832615
(2S,6R,10S)-1,3,7-trimethyl-10-(6-methylhept-5-en-2-yl)-11-oxatricyclo[5.3.1.02,6]undec-3-ene (PubChem CID 22832615) has the molecular formula C21H34O and a molecular weight of 302.50 g/mol. Its IUPAC name is (2S,6R,10S)-1,3,7-trimethyl-10-(6-methylhept-5-en-2-yl)-11-oxatricyclo[5.3.1.02,6]undec-3-ene.
| Compound Name | (2S,6R,10S)-1,3,7-trimethyl-10-(6-methylhept-5-en-2-yl)-11-oxatricyclo[5.3.1.02,6]undec-3-ene |
|---|---|
| PubChem CID | 22832615 |
| Molecular Formula | C21H34O |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | (2S,6R,10S)-1,3,7-trimethyl-10-(6-methylhept-5-en-2-yl)-11-oxatricyclo[5.3.1.02,6]undec-3-ene |
| SMILES | CC(C)=CCCC(C)[C@@H]1CCC2(C)OC1(C)[C@@H]1C(C)=CC[C@H]12 |
| InChI | InChI=1S/C21H34O/c1-14(2)8-7-9-15(3)17-12-13-20(5)18-11-10-16(4)19(18)21(17,6)22-20/h8,10,15,17-19H,7,9,11-13H2,1-6H3/t15?,17-,18+,19+,20?,21?/m0/s1 |
| InChIKey | XWFJLOYHBNLEKC-UWYVVVEVSA-N |
| XLogP | 5.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|