C25H38O3 — CID 162864729
(Z,6S)-6-[(1R,3R,6S,7S,9Z,11S,14R)-14-hydroxy-3,10,14-trimethyl-12-oxo-6-tricyclo[9.3.0.03,7]tetradec-9-enyl]-2-methylhept-2-enal (PubChem CID 162864729) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is (Z,6S)-6-[(1R,3R,6S,7S,9Z,11S,14R)-14-hydroxy-3,10,14-trimethyl-12-oxo-6-tricyclo[9.3.0.03,7]tetradec-9-enyl]-2-methylhept-2-enal.
| Compound Name | (Z,6S)-6-[(1R,3R,6S,7S,9Z,11S,14R)-14-hydroxy-3,10,14-trimethyl-12-oxo-6-tricyclo[9.3.0.03,7]tetradec-9-enyl]-2-methylhept-2-enal |
|---|---|
| PubChem CID | 162864729 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | (Z,6S)-6-[(1R,3R,6S,7S,9Z,11S,14R)-14-hydroxy-3,10,14-trimethyl-12-oxo-6-tricyclo[9.3.0.03,7]tetradec-9-enyl]-2-methylhept-2-enal |
| SMILES | C/C(C=O)=C/CC[C@H](C)[C@@H]1CC[C@]2(C)C[C@@H]3[C@H](C(=O)C[C@@]3(C)O)/C(C)=C\C[C@@H]12 |
| InChI | InChI=1S/C25H38O3/c1-16(15-26)7-6-8-17(2)19-11-12-24(4)13-21-23(18(3)9-10-20(19)24)22(27)14-25(21,5)28/h7,9,15,17,19-21,23,28H,6,8,10-14H2,1-5H3/b16-7-,18-9-/t17-,19-,20-,21+,23+,24+,25+/m0/s1 |
| InChIKey | ZJBUGILYFJGAAU-APIQLJDESA-N |
| XLogP | 5.28 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|