C19H30O — CID 163028991
(1E,4E,8R)-5-methyl-8-[(2R)-6-methylhept-5-en-2-yl]cyclonona-1,4-diene-1-carbaldehyde (PubChem CID 163028991) has the molecular formula C19H30O and a molecular weight of 274.45 g/mol. Its IUPAC name is (1E,4E,8R)-5-methyl-8-[(2R)-6-methylhept-5-en-2-yl]cyclonona-1,4-diene-1-carbaldehyde.
| Compound Name | (1E,4E,8R)-5-methyl-8-[(2R)-6-methylhept-5-en-2-yl]cyclonona-1,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 163028991 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | (1E,4E,8R)-5-methyl-8-[(2R)-6-methylhept-5-en-2-yl]cyclonona-1,4-diene-1-carbaldehyde |
| SMILES | CC(C)=CCC[C@@H](C)[C@@H]1CC/C(C)=C/C/C=C(/C=O)C1 |
| InChI | InChI=1S/C19H30O/c1-15(2)7-5-9-17(4)19-12-11-16(3)8-6-10-18(13-19)14-20/h7-8,10,14,17,19H,5-6,9,11-13H2,1-4H3/b16-8+,18-10+/t17-,19-/m1/s1 |
| InChIKey | BOKICKKUMVGYBA-LBBUYANXSA-N |
| XLogP | 5.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|