C22H32O4 — CID 162828692
[2-(2,3-diformyl-7-methylcyclonona-3,6-dien-1-yl)-6-methylhept-5-enyl] acetate (PubChem CID 162828692) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is [2-(2,3-diformyl-7-methylcyclonona-3,6-dien-1-yl)-6-methylhept-5-enyl] acetate.
| Compound Name | [2-(2,3-diformyl-7-methylcyclonona-3,6-dien-1-yl)-6-methylhept-5-enyl] acetate |
|---|---|
| PubChem CID | 162828692 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | [2-(2,3-diformyl-7-methylcyclonona-3,6-dien-1-yl)-6-methylhept-5-enyl] acetate |
| SMILES | CC(=O)OCC(CCC=C(C)C)C1CCC(C)=CCC=C(C=O)C1C=O |
| InChI | InChI=1S/C22H32O4/c1-16(2)7-5-10-20(15-26-18(4)25)21-12-11-17(3)8-6-9-19(13-23)22(21)14-24/h7-9,13-14,20-22H,5-6,10-12,15H2,1-4H3 |
| InChIKey | YQUKFUMDEVAPHO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|