C17H32O2 — CID 23092808
(1Z)-1-methyl-5,6-bis[(2-methylpropan-2-yl)oxy]cyclooctene (PubChem CID 23092808) has the molecular formula C17H32O2 and a molecular weight of 268.44 g/mol. Its IUPAC name is (1Z)-1-methyl-5,6-bis[(2-methylpropan-2-yl)oxy]cyclooctene.
| Compound Name | (1Z)-1-methyl-5,6-bis[(2-methylpropan-2-yl)oxy]cyclooctene |
|---|---|
| PubChem CID | 23092808 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | (1Z)-1-methyl-5,6-bis[(2-methylpropan-2-yl)oxy]cyclooctene |
| SMILES | C/C1=C/CCC(OC(C)(C)C)C(OC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H32O2/c1-13-9-8-10-14(18-16(2,3)4)15(12-11-13)19-17(5,6)7/h9,14-15H,8,10-12H2,1-7H3/b13-9- |
| InChIKey | YBPKSVJKJXZJEP-LCYFTJDESA-N |
| XLogP | 4.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|