C9H6Cl2 — CID 139796127
1,4-dichloro-1H-indene (PubChem CID 139796127) has the molecular formula C9H6Cl2 and a molecular weight of 185.05 g/mol. Its IUPAC name is 1,4-dichloro-1H-indene.
| Compound Name | 1,4-dichloro-1H-indene |
|---|---|
| PubChem CID | 139796127 |
| Molecular Formula | C9H6Cl2 |
| Molecular Weight | 185.05 g/mol |
| Exact Mass | 183.98 |
| IUPAC Name | 1,4-dichloro-1H-indene |
| SMILES | Clc1cccc2c1C=CC2Cl |
| InChI | InChI=1S/C9H6Cl2/c10-8-3-1-2-6-7(8)4-5-9(6)11/h1-5,9H |
| InChIKey | RZYLWBLUPGPZJR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.05 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|