C11H9ClO — CID 18601286
(3aR,8bR)-5-chloro-3a,8b-dihydro-3H-cyclopenta[b][1]benzofuran (PubChem CID 18601286) has the molecular formula C11H9ClO and a molecular weight of 192.65 g/mol. Its IUPAC name is (3aR,8bR)-5-chloro-3a,8b-dihydro-3H-cyclopenta[b][1]benzofuran.
| Compound Name | (3aR,8bR)-5-chloro-3a,8b-dihydro-3H-cyclopenta[b][1]benzofuran |
|---|---|
| PubChem CID | 18601286 |
| Molecular Formula | C11H9ClO |
| Molecular Weight | 192.65 g/mol |
| Exact Mass | 192.03 |
| IUPAC Name | (3aR,8bR)-5-chloro-3a,8b-dihydro-3H-cyclopenta[b][1]benzofuran |
| SMILES | Clc1cccc2c1O[C@@H]1CC=C[C@H]21 |
| InChI | InChI=1S/C11H9ClO/c12-9-5-1-4-8-7-3-2-6-10(7)13-11(8)9/h1-5,7,10H,6H2/t7-,10-/m1/s1 |
| InChIKey | OMDNLQNEYAIGGQ-GMSGAONNSA-N |
| XLogP | 3.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.65 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|