C18H15BrCl2O2 — CID 11080170
(1S,9R)-13-bromo-6-chloro-12-(4-chlorophenoxy)-8-oxatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene (PubChem CID 11080170) has the molecular formula C18H15BrCl2O2 and a molecular weight of 414.13 g/mol. Its IUPAC name is (1S,9R)-13-bromo-6-chloro-12-(4-chlorophenoxy)-8-oxatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene.
| Compound Name | (1S,9R)-13-bromo-6-chloro-12-(4-chlorophenoxy)-8-oxatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene |
|---|---|
| PubChem CID | 11080170 |
| Molecular Formula | C18H15BrCl2O2 |
| Molecular Weight | 414.13 g/mol |
| Exact Mass | 411.96 |
| IUPAC Name | (1S,9R)-13-bromo-6-chloro-12-(4-chlorophenoxy)-8-oxatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene |
| SMILES | Clc1ccc(OC2CC[C@H]3Oc4c(Cl)cccc4[C@@H]2C3Br)cc1 |
| InChI | InChI=1S/C18H15BrCl2O2/c19-17-15-9-8-14(22-11-6-4-10(20)5-7-11)16(17)12-2-1-3-13(21)18(12)23-15/h1-7,14-17H,8-9H2/t14?,15-,16+,17?/m1/s1 |
| InChIKey | MRNJUZAIZDJFHM-GMRIPVOYSA-N |
| XLogP | 5.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.13 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|