C9H9ClOS — CID 130760391
8-chloro-3,4-dihydro-2H-chromene-4-thiol (PubChem CID 130760391) has the molecular formula C9H9ClOS and a molecular weight of 200.69 g/mol. Its IUPAC name is 8-chloro-3,4-dihydro-2H-chromene-4-thiol.
| Compound Name | 8-chloro-3,4-dihydro-2H-chromene-4-thiol |
|---|---|
| PubChem CID | 130760391 |
| Molecular Formula | C9H9ClOS |
| Molecular Weight | 200.69 g/mol |
| Exact Mass | 200.01 |
| IUPAC Name | 8-chloro-3,4-dihydro-2H-chromene-4-thiol |
| SMILES | SC1CCOc2c(Cl)cccc21 |
| InChI | InChI=1S/C9H9ClOS/c10-7-3-1-2-6-8(12)4-5-11-9(6)7/h1-3,8,12H,4-5H2 |
| InChIKey | FRYPAKWMZWPTDL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.69 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|