About 1,5-dichloro-3-methylidenecyclohexa-1,4-diene
1,5-dichloro-3-methylidenecyclohexa-1,4-diene (PubChem CID 135897186) has the molecular formula C7H6Cl2
and a molecular weight of 161.03 g/mol. Its IUPAC name is 1,5-dichloro-3-methylidenecyclohexa-1,4-diene.
Analyze 1,5-dichloro-3-methylidenecyclohexa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dichloro-3-methylidenecyclohexa-1,4-diene?
The IUPAC name of 1,5-dichloro-3-methylidenecyclohexa-1,4-diene (CID 135897186) is 1,5-dichloro-3-methylidenecyclohexa-1,4-diene.
What is the SMILES notation for 1,5-dichloro-3-methylidenecyclohexa-1,4-diene?
The canonical SMILES for 1,5-dichloro-3-methylidenecyclohexa-1,4-diene is C=C1C=C(Cl)CC(Cl)=C1.
What is the InChIKey of 1,5-dichloro-3-methylidenecyclohexa-1,4-diene?
The InChIKey is LEPDNLWFKALLJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6Cl2/c1-5-2-6(8)4-7(9)3-5/h2-3H,1,4H2.
What are the key properties of 1,5-dichloro-3-methylidenecyclohexa-1,4-diene?
1,5-dichloro-3-methylidenecyclohexa-1,4-diene has a molecular weight of 161.03 g/mol, XLogP of 3.19, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dichloro-3-methylidenecyclohexa-1,4-diene is sourced from PubChem (CID 135897186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).