C9H12I- — CID 163718956
3-methyl-5-methylidene-1-methyliodanuidylcyclohexa-1,3-diene (PubChem CID 163718956) has the molecular formula C9H12I- and a molecular weight of 247.10 g/mol. Its IUPAC name is 3-methyl-5-methylidene-1-methyliodanuidylcyclohexa-1,3-diene.
| Compound Name | 3-methyl-5-methylidene-1-methyliodanuidylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 163718956 |
| Molecular Formula | C9H12I- |
| Molecular Weight | 247.10 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | 3-methyl-5-methylidene-1-methyliodanuidylcyclohexa-1,3-diene |
| SMILES | C=C1C=C(C)C=C([I-]C)C1 |
| InChI | InChI=1S/C9H12I/c1-7-4-8(2)6-9(5-7)10-3/h4,6H,1,5H2,2-3H3/q-1 |
| InChIKey | KLFYJRHMKULGQG-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.10 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|