C10H9NO2 — CID 89261226
(E)-3-(6-imino-3-methylidenecyclohexa-1,4-dien-1-yl)prop-2-enoic acid (PubChem CID 89261226) has the molecular formula C10H9NO2 and a molecular weight of 175.19 g/mol. Its IUPAC name is (E)-3-(6-imino-3-methylidenecyclohexa-1,4-dien-1-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(6-imino-3-methylidenecyclohexa-1,4-dien-1-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 89261226 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | (E)-3-(6-imino-3-methylidenecyclohexa-1,4-dien-1-yl)prop-2-enoic acid |
| SMILES | [H]/N=C1\C=CC(=C)C=C1/C=C/C(=O)O |
| InChI | InChI=1S/C10H9NO2/c1-7-2-4-9(11)8(6-7)3-5-10(12)13/h2-6,11H,1H2,(H,12,13)/b5-3+,11-9+ |
| InChIKey | WHUXKTARLARTPY-QHROSOOBSA-N |
| XLogP | 1.70 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|