C13H12S — CID 144601364
(3Z,5Z)-4-methyl-2-methylidene-1-benzothiocine (PubChem CID 144601364) has the molecular formula C13H12S and a molecular weight of 200.31 g/mol. Its IUPAC name is (3Z,5Z)-4-methyl-2-methylidene-1-benzothiocine.
| Compound Name | (3Z,5Z)-4-methyl-2-methylidene-1-benzothiocine |
|---|---|
| PubChem CID | 144601364 |
| Molecular Formula | C13H12S |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | (3Z,5Z)-4-methyl-2-methylidene-1-benzothiocine |
| SMILES | C=C1/C=C(C)\C=C/c2ccccc2S1 |
| InChI | InChI=1S/C13H12S/c1-10-7-8-12-5-3-4-6-13(12)14-11(2)9-10/h3-9H,2H2,1H3/b8-7-,10-9- |
| InChIKey | YFBSILKUGJMEPL-QRLRYFCNSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |