C6H5IO2 — CID 140968042
1-iodyl-5-methylidenecyclopenta-1,3-diene (PubChem CID 140968042) has the molecular formula C6H5IO2 and a molecular weight of 236.01 g/mol. Its IUPAC name is 1-iodyl-5-methylidenecyclopenta-1,3-diene.
| Compound Name | 1-iodyl-5-methylidenecyclopenta-1,3-diene |
|---|---|
| PubChem CID | 140968042 |
| Molecular Formula | C6H5IO2 |
| Molecular Weight | 236.01 g/mol |
| Exact Mass | 235.93 |
| IUPAC Name | 1-iodyl-5-methylidenecyclopenta-1,3-diene |
| SMILES | C=C1C=CC=C1I(=O)=O |
| InChI | InChI=1S/C6H5IO2/c1-5-3-2-4-6(5)7(8)9/h2-4H,1H2 |
| InChIKey | WAICDEBOQXTMGR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.01 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|