C13H18 — CID 58519935
(1Z,3Z,5Z,7Z)-1,2,3,4,5-pentamethylcycloocta-1,3,5,7-tetraene (PubChem CID 58519935) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is (1Z,3Z,5Z,7Z)-1,2,3,4,5-pentamethylcycloocta-1,3,5,7-tetraene.
| Compound Name | (1Z,3Z,5Z,7Z)-1,2,3,4,5-pentamethylcycloocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 58519935 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | (1Z,3Z,5Z,7Z)-1,2,3,4,5-pentamethylcycloocta-1,3,5,7-tetraene |
| SMILES | CC1=C/C=C\C(C)=C(C)/C(C)=C\1C |
| InChI | InChI=1S/C13H18/c1-9-7-6-8-10(2)12(4)13(5)11(9)3/h6-8H,1-5H3/b7-6-,8-6-,9-7-,10-8-,11-9-,12-10-,13-11-,13-12- |
| InChIKey | PCMLOVDEVVCOBJ-CXUNNILFSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |