C8H10O2 — CID 73169366
methoxy-(2-methylcyclopenta-2,4-dien-1-ylidene)methanol (PubChem CID 73169366) has the molecular formula C8H10O2 and a molecular weight of 138.17 g/mol. Its IUPAC name is methoxy-(2-methylcyclopenta-2,4-dien-1-ylidene)methanol.
| Compound Name | methoxy-(2-methylcyclopenta-2,4-dien-1-ylidene)methanol |
|---|---|
| PubChem CID | 73169366 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | methoxy-(2-methylcyclopenta-2,4-dien-1-ylidene)methanol |
| SMILES | COC(O)=C1C=CC=C1C |
| InChI | InChI=1S/C8H10O2/c1-6-4-3-5-7(6)8(9)10-2/h3-5,9H,1-2H3 |
| InChIKey | KMYHJZPGPCTPLK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|