C9H9O3- — CID 54708782
(1E)-1-(2-methoxycarbonylcyclopenta-2,4-dien-1-ylidene)ethanolate (PubChem CID 54708782) has the molecular formula C9H9O3- and a molecular weight of 165.17 g/mol. Its IUPAC name is (1E)-1-(2-methoxycarbonylcyclopenta-2,4-dien-1-ylidene)ethanolate.
| Compound Name | (1E)-1-(2-methoxycarbonylcyclopenta-2,4-dien-1-ylidene)ethanolate |
|---|---|
| PubChem CID | 54708782 |
| Molecular Formula | C9H9O3- |
| Molecular Weight | 165.17 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | (1E)-1-(2-methoxycarbonylcyclopenta-2,4-dien-1-ylidene)ethanolate |
| SMILES | COC(=O)C1=CC=C/C1=C(/C)[O-] |
| InChI | InChI=1S/C9H10O3/c1-6(10)7-4-3-5-8(7)9(11)12-2/h3-5,10H,1-2H3/p-1/b7-6+ |
| InChIKey | JTRNZSNKXGQACF-VOTSOKGWSA-M |
| XLogP | 0.29 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.17 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|