C8H10ClNO2 — CID 70547433
methyl 6-iminocyclohexa-1,3-diene-1-carboxylate;hydrochloride (PubChem CID 70547433) has the molecular formula C8H10ClNO2 and a molecular weight of 187.63 g/mol. Its IUPAC name is methyl 6-iminocyclohexa-1,3-diene-1-carboxylate;hydrochloride.
| Compound Name | methyl 6-iminocyclohexa-1,3-diene-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 70547433 |
| Molecular Formula | C8H10ClNO2 |
| Molecular Weight | 187.63 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | methyl 6-iminocyclohexa-1,3-diene-1-carboxylate;hydrochloride |
| SMILES | Cl.[H]/N=C1\CC=CC=C1C(=O)OC |
| InChI | InChI=1S/C8H9NO2.ClH/c1-11-8(10)6-4-2-3-5-7(6)9;/h2-4,9H,5H2,1H3;1H/b9-7+; |
| InChIKey | FVFOJYLIAZDERL-BXTVWIJMSA-N |
| XLogP | 1.49 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.63 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|