C7H9NO — CID 68995450
2-methoxycyclohexa-2,4-dien-1-imine (PubChem CID 68995450) has the molecular formula C7H9NO and a molecular weight of 123.15 g/mol. Its IUPAC name is 2-methoxycyclohexa-2,4-dien-1-imine.
| Compound Name | 2-methoxycyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 68995450 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | 2-methoxycyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1\CC=CC=C1OC |
| InChI | InChI=1S/C7H9NO/c1-9-7-5-3-2-4-6(7)8/h2-3,5,8H,4H2,1H3/b8-6+ |
| InChIKey | UMLCZOCXPGLPPR-SOFGYWHQSA-N |
| XLogP | 1.50 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|