C15H23NO — CID 141148731
N-[(2Z,4Z,6Z)-2,3,4-trimethylcyclododeca-2,4,6-trien-1-ylidene]hydroxylamine (PubChem CID 141148731) has the molecular formula C15H23NO and a molecular weight of 233.36 g/mol. Its IUPAC name is N-[(2Z,4Z,6Z)-2,3,4-trimethylcyclododeca-2,4,6-trien-1-ylidene]hydroxylamine.
| Compound Name | N-[(2Z,4Z,6Z)-2,3,4-trimethylcyclododeca-2,4,6-trien-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 141148731 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | N-[(2Z,4Z,6Z)-2,3,4-trimethylcyclododeca-2,4,6-trien-1-ylidene]hydroxylamine |
| SMILES | CC1=C/C=C\CCCCCC(=NO)/C(C)=C\1C |
| InChI | InChI=1S/C15H23NO/c1-12-10-8-6-4-5-7-9-11-15(16-17)14(3)13(12)2/h6,8,10,17H,4-5,7,9,11H2,1-3H3/b8-6-,12-10-,14-13-,16-15? |
| InChIKey | ZTCRFVAZUMZFAT-KAHCFUCNSA-N |
| XLogP | 4.62 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|