C7H9NO — CID 172985783
(NZ)-N-(2-methylcyclohexa-2,4-dien-1-ylidene)hydroxylamine (PubChem CID 172985783) has the molecular formula C7H9NO and a molecular weight of 123.15 g/mol. Its IUPAC name is (NZ)-N-(2-methylcyclohexa-2,4-dien-1-ylidene)hydroxylamine.
| Compound Name | (NZ)-N-(2-methylcyclohexa-2,4-dien-1-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 172985783 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | (NZ)-N-(2-methylcyclohexa-2,4-dien-1-ylidene)hydroxylamine |
| SMILES | CC1=CC=CC/C1=N/O |
| InChI | InChI=1S/C7H9NO/c1-6-4-2-3-5-7(6)8-9/h2-4,9H,5H2,1H3/b8-7- |
| InChIKey | UXRNTKVYIWYXRI-FPLPWBNLSA-N |
| XLogP | 1.72 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|