C17H23N — CID 173119428
N-tert-butyl-2-(2,5-dimethylcyclopenta-2,4-dien-1-yl)cyclohexa-2,4-dien-1-imine (PubChem CID 173119428) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is N-tert-butyl-2-(2,5-dimethylcyclopenta-2,4-dien-1-yl)cyclohexa-2,4-dien-1-imine.
| Compound Name | N-tert-butyl-2-(2,5-dimethylcyclopenta-2,4-dien-1-yl)cyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 173119428 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | N-tert-butyl-2-(2,5-dimethylcyclopenta-2,4-dien-1-yl)cyclohexa-2,4-dien-1-imine |
| SMILES | CC1=CC=C(C)C1C1=CC=CC/C1=N\C(C)(C)C |
| InChI | InChI=1S/C17H23N/c1-12-10-11-13(2)16(12)14-8-6-7-9-15(14)18-17(3,4)5/h6-8,10-11,16H,9H2,1-5H3/b18-15+ |
| InChIKey | KDTGISAOIHWJGW-OBGWFSINSA-N |
| XLogP | 4.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|