C12H16Hf — CID 175907032
hafnium;bis(1-methylcyclopenta-1,3-diene) (PubChem CID 175907032) has the molecular formula C12H16Hf and a molecular weight of 338.75 g/mol. Its IUPAC name is hafnium;bis(1-methylcyclopenta-1,3-diene).
| Compound Name | hafnium;bis(1-methylcyclopenta-1,3-diene) |
|---|---|
| PubChem CID | 175907032 |
| Molecular Formula | C12H16Hf |
| Molecular Weight | 338.75 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | hafnium;bis(1-methylcyclopenta-1,3-diene) |
| SMILES | CC1=CC=CC1.CC1=CC=CC1.[Hf] |
| InChI | InChI=1S/2C6H8.Hf/c2*1-6-4-2-3-5-6;/h2*2-4H,5H2,1H3; |
| InChIKey | XCOLGFCGPOKIRT-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.75 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |