About sodium;di(cyclopenta-1,3-dien-1-yl)-methylsilane;hydride
sodium;di(cyclopenta-1,3-dien-1-yl)-methylsilane;hydride (PubChem CID 173341596) has the molecular formula C11H15NaSi
and a molecular weight of 198.32 g/mol. Its IUPAC name is sodium;di(cyclopenta-1,3-dien-1-yl)-methylsilane;hydride.
Molecular Properties
| Compound Name | sodium;di(cyclopenta-1,3-dien-1-yl)-methylsilane;hydride |
| PubChem CID | 173341596 |
| Molecular Formula | C11H15NaSi |
| Molecular Weight | 198.32 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | sodium;di(cyclopenta-1,3-dien-1-yl)-methylsilane;hydride |
| SMILES | C[SiH](C1=CC=CC1)C1=CC=CC1.[H-].[Na+] |
| InChI | InChI=1S/C11H14Si.Na.H/c1-12(10-6-2-3-7-10)11-8-4-5-9-11;;/h2-6,8,12H,7,9H2,1H3;;/q;+1;-1 |
| InChIKey | DYLLYZAFRSRAPU-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.32 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sodium;di(cyclopenta-1,3-dien-1-yl)-methylsilane;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;di(cyclopenta-1,3-dien-1-yl)-methylsilane;hydride?
The IUPAC name of sodium;di(cyclopenta-1,3-dien-1-yl)-methylsilane;hydride (CID 173341596) is sodium;di(cyclopenta-1,3-dien-1-yl)-methylsilane;hydride.
What is the SMILES notation for sodium;di(cyclopenta-1,3-dien-1-yl)-methylsilane;hydride?
The canonical SMILES for sodium;di(cyclopenta-1,3-dien-1-yl)-methylsilane;hydride is C[SiH](C1=CC=CC1)C1=CC=CC1.[H-].[Na+].
What is the InChIKey of sodium;di(cyclopenta-1,3-dien-1-yl)-methylsilane;hydride?
The InChIKey is DYLLYZAFRSRAPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14Si.Na.H/c1-12(10-6-2-3-7-10)11-8-4-5-9-11;;/h2-6,8,12H,7,9H2,1H3;;/q;+1;-1.
What are the key properties of sodium;di(cyclopenta-1,3-dien-1-yl)-methylsilane;hydride?
sodium;di(cyclopenta-1,3-dien-1-yl)-methylsilane;hydride has a molecular weight of 198.32 g/mol, XLogP of -0.19, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;di(cyclopenta-1,3-dien-1-yl)-methylsilane;hydride is sourced from PubChem (CID 173341596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).