About 2-cyclopropyl-1,3-dimethylcyclohepta-1,3,5-triene
2-cyclopropyl-1,3-dimethylcyclohepta-1,3,5-triene (PubChem CID 121009040) has the molecular formula C12H16
and a molecular weight of 160.26 g/mol. Its IUPAC name is 2-cyclopropyl-1,3-dimethylcyclohepta-1,3,5-triene.
Analyze 2-cyclopropyl-1,3-dimethylcyclohepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-1,3-dimethylcyclohepta-1,3,5-triene?
The IUPAC name of 2-cyclopropyl-1,3-dimethylcyclohepta-1,3,5-triene (CID 121009040) is 2-cyclopropyl-1,3-dimethylcyclohepta-1,3,5-triene.
What is the SMILES notation for 2-cyclopropyl-1,3-dimethylcyclohepta-1,3,5-triene?
The canonical SMILES for 2-cyclopropyl-1,3-dimethylcyclohepta-1,3,5-triene is CC1=CC=CCC(C)=C1C1CC1.
What is the InChIKey of 2-cyclopropyl-1,3-dimethylcyclohepta-1,3,5-triene?
The InChIKey is AKBYPQGWRDLCAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16/c1-9-5-3-4-6-10(2)12(9)11-7-8-11/h3-5,11H,6-8H2,1-2H3.
What are the key properties of 2-cyclopropyl-1,3-dimethylcyclohepta-1,3,5-triene?
2-cyclopropyl-1,3-dimethylcyclohepta-1,3,5-triene has a molecular weight of 160.26 g/mol, XLogP of 3.62, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-1,3-dimethylcyclohepta-1,3,5-triene is sourced from PubChem (CID 121009040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).