C12H18O — CID 143900403
ethane;8-methyl-3,4-dihydro-2H-cyclohepta[b]furan (PubChem CID 143900403) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is ethane;8-methyl-3,4-dihydro-2H-cyclohepta[b]furan.
| Compound Name | ethane;8-methyl-3,4-dihydro-2H-cyclohepta[b]furan |
|---|---|
| PubChem CID | 143900403 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | ethane;8-methyl-3,4-dihydro-2H-cyclohepta[b]furan |
| SMILES | CC.CC1=CC=CCC2=C1OCC2 |
| InChI | InChI=1S/C10H12O.C2H6/c1-8-4-2-3-5-9-6-7-11-10(8)9;1-2/h2-4H,5-7H2,1H3;1-2H3 |
| InChIKey | DWENBFPCBKRMGM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |