C14H26O — CID 144506345
4,7-dimethyl-2,3,5,6-tetrahydro-1-benzofuran;ethane (PubChem CID 144506345) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is 4,7-dimethyl-2,3,5,6-tetrahydro-1-benzofuran;ethane.
| Compound Name | 4,7-dimethyl-2,3,5,6-tetrahydro-1-benzofuran;ethane |
|---|---|
| PubChem CID | 144506345 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | 4,7-dimethyl-2,3,5,6-tetrahydro-1-benzofuran;ethane |
| SMILES | CC.CC.CC1=C2CCOC2=C(C)CC1 |
| InChI | InChI=1S/C10H14O.2C2H6/c1-7-3-4-8(2)10-9(7)5-6-11-10;2*1-2/h3-6H2,1-2H3;2*1-2H3 |
| InChIKey | FAYPNVMCBHBQPY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |