C8H7BrO2 — CID 175392448
4-bromo-3,6-dihydro-2H-1-benzofuran-7-one (PubChem CID 175392448) has the molecular formula C8H7BrO2 and a molecular weight of 215.05 g/mol. Its IUPAC name is 4-bromo-3,6-dihydro-2H-1-benzofuran-7-one.
| Compound Name | 4-bromo-3,6-dihydro-2H-1-benzofuran-7-one |
|---|---|
| PubChem CID | 175392448 |
| Molecular Formula | C8H7BrO2 |
| Molecular Weight | 215.05 g/mol |
| Exact Mass | 213.96 |
| IUPAC Name | 4-bromo-3,6-dihydro-2H-1-benzofuran-7-one |
| SMILES | O=C1CC=C(Br)C2=C1OCC2 |
| InChI | InChI=1S/C8H7BrO2/c9-6-1-2-7(10)8-5(6)3-4-11-8/h1H,2-4H2 |
| InChIKey | GNWISEIVKZESDU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.05 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |