C14H15BrO — CID 135067971
9-bromo-2,2,3-trimethyl-7-oxatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene (PubChem CID 135067971) has the molecular formula C14H15BrO and a molecular weight of 279.18 g/mol. Its IUPAC name is 9-bromo-2,2,3-trimethyl-7-oxatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene.
| Compound Name | 9-bromo-2,2,3-trimethyl-7-oxatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene |
|---|---|
| PubChem CID | 135067971 |
| Molecular Formula | C14H15BrO |
| Molecular Weight | 279.18 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 9-bromo-2,2,3-trimethyl-7-oxatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraene |
| SMILES | CC1=C2CCOc3c(Br)ccc(c32)C1(C)C |
| InChI | InChI=1S/C14H15BrO/c1-8-9-6-7-16-13-11(15)5-4-10(12(9)13)14(8,2)3/h4-5H,6-7H2,1-3H3 |
| InChIKey | ASSZOWDKCWEXNJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.18 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |