C9H8BrNO3 — CID 175524233
(4-bromo-2,3-dihydro-1-benzofuran-7-yl) carbamate (PubChem CID 175524233) has the molecular formula C9H8BrNO3 and a molecular weight of 258.07 g/mol. Its IUPAC name is (4-bromo-2,3-dihydro-1-benzofuran-7-yl) carbamate.
| Compound Name | (4-bromo-2,3-dihydro-1-benzofuran-7-yl) carbamate |
|---|---|
| PubChem CID | 175524233 |
| Molecular Formula | C9H8BrNO3 |
| Molecular Weight | 258.07 g/mol |
| Exact Mass | 256.97 |
| IUPAC Name | (4-bromo-2,3-dihydro-1-benzofuran-7-yl) carbamate |
| SMILES | NC(=O)Oc1ccc(Br)c2c1OCC2 |
| InChI | InChI=1S/C9H8BrNO3/c10-6-1-2-7(14-9(11)12)8-5(6)3-4-13-8/h1-2H,3-4H2,(H2,11,12) |
| InChIKey | GNENHEPTBLWYFO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.07 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |