About N-(5,7-dibromo-2,3-dihydro-1-benzofuran-4-yl)acetamide;pentane
N-(5,7-dibromo-2,3-dihydro-1-benzofuran-4-yl)acetamide;pentane (PubChem CID 144855943) has the molecular formula C15H21Br2NO2
and a molecular weight of 407.15 g/mol. Its IUPAC name is N-(5,7-dibromo-2,3-dihydro-1-benzofuran-4-yl)acetamide;pentane.
Molecular Properties
| Compound Name | N-(5,7-dibromo-2,3-dihydro-1-benzofuran-4-yl)acetamide;pentane |
| PubChem CID | 144855943 |
| Molecular Formula | C15H21Br2NO2 |
| Molecular Weight | 407.15 g/mol |
| Exact Mass | 404.99 |
| IUPAC Name | N-(5,7-dibromo-2,3-dihydro-1-benzofuran-4-yl)acetamide;pentane |
| SMILES | CC(=O)Nc1c(Br)cc(Br)c2c1CCO2.CCCCC |
| InChI | InChI=1S/C10H9Br2NO2.C5H12/c1-5(14)13-9-6-2-3-15-10(6)8(12)4-7(9)11;1-3-5-4-2/h4H,2-3H2,1H3,(H,13,14);3-5H2,1-2H3 |
| InChIKey | OCLVBAHYLLELSE-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.15 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(5,7-dibromo-2,3-dihydro-1-benzofuran-4-yl)acetamide;pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5,7-dibromo-2,3-dihydro-1-benzofuran-4-yl)acetamide;pentane?
The IUPAC name of N-(5,7-dibromo-2,3-dihydro-1-benzofuran-4-yl)acetamide;pentane (CID 144855943) is N-(5,7-dibromo-2,3-dihydro-1-benzofuran-4-yl)acetamide;pentane.
What is the SMILES notation for N-(5,7-dibromo-2,3-dihydro-1-benzofuran-4-yl)acetamide;pentane?
The canonical SMILES for N-(5,7-dibromo-2,3-dihydro-1-benzofuran-4-yl)acetamide;pentane is CC(=O)Nc1c(Br)cc(Br)c2c1CCO2.CCCCC.
What is the InChIKey of N-(5,7-dibromo-2,3-dihydro-1-benzofuran-4-yl)acetamide;pentane?
The InChIKey is OCLVBAHYLLELSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9Br2NO2.C5H12/c1-5(14)13-9-6-2-3-15-10(6)8(12)4-7(9)11;1-3-5-4-2/h4H,2-3H2,1H3,(H,13,14);3-5H2,1-2H3.
What are the key properties of N-(5,7-dibromo-2,3-dihydro-1-benzofuran-4-yl)acetamide;pentane?
N-(5,7-dibromo-2,3-dihydro-1-benzofuran-4-yl)acetamide;pentane has a molecular weight of 407.15 g/mol, XLogP of 5.30, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5,7-dibromo-2,3-dihydro-1-benzofuran-4-yl)acetamide;pentane is sourced from PubChem (CID 144855943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).