C6H7BrO2 — CID 10774061
5-bromo-6-methyl-2,3-dihydropyran-4-one (PubChem CID 10774061) has the molecular formula C6H7BrO2 and a molecular weight of 191.02 g/mol. Its IUPAC name is 5-bromo-6-methyl-2,3-dihydropyran-4-one.
| Compound Name | 5-bromo-6-methyl-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 10774061 |
| Molecular Formula | C6H7BrO2 |
| Molecular Weight | 191.02 g/mol |
| Exact Mass | 189.96 |
| IUPAC Name | 5-bromo-6-methyl-2,3-dihydropyran-4-one |
| SMILES | CC1=C(Br)C(=O)CCO1 |
| InChI | InChI=1S/C6H7BrO2/c1-4-6(7)5(8)2-3-9-4/h2-3H2,1H3 |
| InChIKey | BFNVJUQMYFAZQY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.02 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|