C5H5BrO2 — CID 172993016
6-bromo-2,3-dihydropyran-4-one (PubChem CID 172993016) has the molecular formula C5H5BrO2 and a molecular weight of 177.00 g/mol. Its IUPAC name is 6-bromo-2,3-dihydropyran-4-one.
| Compound Name | 6-bromo-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 172993016 |
| Molecular Formula | C5H5BrO2 |
| Molecular Weight | 177.00 g/mol |
| Exact Mass | 175.95 |
| IUPAC Name | 6-bromo-2,3-dihydropyran-4-one |
| SMILES | O=C1C=C(Br)OCC1 |
| InChI | InChI=1S/C5H5BrO2/c6-5-3-4(7)1-2-8-5/h3H,1-2H2 |
| InChIKey | LXFQDOKSVCHGHN-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.00 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |