About ethane;3-methyl-5,6-dihydrofuro[2,3-c]pyridazine
ethane;3-methyl-5,6-dihydrofuro[2,3-c]pyridazine (PubChem CID 145497461) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is ethane;3-methyl-5,6-dihydrofuro[2,3-c]pyridazine.
Molecular Properties
| Compound Name | ethane;3-methyl-5,6-dihydrofuro[2,3-c]pyridazine |
| PubChem CID | 145497461 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | ethane;3-methyl-5,6-dihydrofuro[2,3-c]pyridazine |
| SMILES | CC.Cc1cc2c(nn1)OCC2 |
| InChI | InChI=1S/C7H8N2O.C2H6/c1-5-4-6-2-3-10-7(6)9-8-5;1-2/h4H,2-3H2,1H3;1-2H3 |
| InChIKey | PHCWRDLIKCELAE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;3-methyl-5,6-dihydrofuro[2,3-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-5,6-dihydrofuro[2,3-c]pyridazine?
The IUPAC name of ethane;3-methyl-5,6-dihydrofuro[2,3-c]pyridazine (CID 145497461) is ethane;3-methyl-5,6-dihydrofuro[2,3-c]pyridazine.
What is the SMILES notation for ethane;3-methyl-5,6-dihydrofuro[2,3-c]pyridazine?
The canonical SMILES for ethane;3-methyl-5,6-dihydrofuro[2,3-c]pyridazine is CC.Cc1cc2c(nn1)OCC2.
What is the InChIKey of ethane;3-methyl-5,6-dihydrofuro[2,3-c]pyridazine?
The InChIKey is PHCWRDLIKCELAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O.C2H6/c1-5-4-6-2-3-10-7(6)9-8-5;1-2/h4H,2-3H2,1H3;1-2H3.
What are the key properties of ethane;3-methyl-5,6-dihydrofuro[2,3-c]pyridazine?
ethane;3-methyl-5,6-dihydrofuro[2,3-c]pyridazine has a molecular weight of 166.22 g/mol, XLogP of 1.75, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-5,6-dihydrofuro[2,3-c]pyridazine is sourced from PubChem (CID 145497461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).