C12H12N2O — CID 129415963
7-methyl-2,3-dihydrofuro[2,3-b]quinolin-8-amine (PubChem CID 129415963) has the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. Its IUPAC name is 7-methyl-2,3-dihydrofuro[2,3-b]quinolin-8-amine.
| Compound Name | 7-methyl-2,3-dihydrofuro[2,3-b]quinolin-8-amine |
|---|---|
| PubChem CID | 129415963 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 7-methyl-2,3-dihydrofuro[2,3-b]quinolin-8-amine |
| SMILES | Cc1ccc2cc3c(nc2c1N)OCC3 |
| InChI | InChI=1S/C12H12N2O/c1-7-2-3-8-6-9-4-5-15-12(9)14-11(8)10(7)13/h2-3,6H,4-5,13H2,1H3 |
| InChIKey | YRKWYDSDZGRMHM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|