About 2-methylphenazin-1-amine
2-methylphenazin-1-amine (PubChem CID 19757586) has the molecular formula C13H11N3
and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-methylphenazin-1-amine.
Molecular Properties
| Compound Name | 2-methylphenazin-1-amine |
| PubChem CID | 19757586 |
| Molecular Formula | C13H11N3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 2-methylphenazin-1-amine |
| SMILES | Cc1ccc2nc3ccccc3nc2c1N |
| InChI | InChI=1S/C13H11N3/c1-8-6-7-11-13(12(8)14)16-10-5-3-2-4-9(10)15-11/h2-7H,14H2,1H3 |
| InChIKey | QGANSTMZHAARDB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylphenazin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylphenazin-1-amine?
The IUPAC name of 2-methylphenazin-1-amine (CID 19757586) is 2-methylphenazin-1-amine.
What is the SMILES notation for 2-methylphenazin-1-amine?
The canonical SMILES for 2-methylphenazin-1-amine is Cc1ccc2nc3ccccc3nc2c1N.
What is the InChIKey of 2-methylphenazin-1-amine?
The InChIKey is QGANSTMZHAARDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3/c1-8-6-7-11-13(12(8)14)16-10-5-3-2-4-9(10)15-11/h2-7H,14H2,1H3.
What are the key properties of 2-methylphenazin-1-amine?
2-methylphenazin-1-amine has a molecular weight of 209.25 g/mol, XLogP of 2.67, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylphenazin-1-amine is sourced from PubChem (CID 19757586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).