About 2,3-diaminophenazin-1-ol
2,3-diaminophenazin-1-ol (PubChem CID 171618419) has the molecular formula C12H10N4O
and a molecular weight of 226.24 g/mol. Its IUPAC name is 2,3-diaminophenazin-1-ol.
Molecular Properties
| Compound Name | 2,3-diaminophenazin-1-ol |
| PubChem CID | 171618419 |
| Molecular Formula | C12H10N4O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 2,3-diaminophenazin-1-ol |
| SMILES | Nc1cc2nc3ccccc3nc2c(O)c1N |
| InChI | InChI=1S/C12H10N4O/c13-6-5-9-11(12(17)10(6)14)16-8-4-2-1-3-7(8)15-9/h1-5,17H,13-14H2 |
| InChIKey | GGHGSDPOUAZWFL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2,3-diaminophenazin-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diaminophenazin-1-ol?
The IUPAC name of 2,3-diaminophenazin-1-ol (CID 171618419) is 2,3-diaminophenazin-1-ol.
What is the SMILES notation for 2,3-diaminophenazin-1-ol?
The canonical SMILES for 2,3-diaminophenazin-1-ol is Nc1cc2nc3ccccc3nc2c(O)c1N.
What is the InChIKey of 2,3-diaminophenazin-1-ol?
The InChIKey is GGHGSDPOUAZWFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4O/c13-6-5-9-11(12(17)10(6)14)16-8-4-2-1-3-7(8)15-9/h1-5,17H,13-14H2.
What are the key properties of 2,3-diaminophenazin-1-ol?
2,3-diaminophenazin-1-ol has a molecular weight of 226.24 g/mol, XLogP of 1.65, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diaminophenazin-1-ol is sourced from PubChem (CID 171618419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).