About 1-aminophenazin-2-ol
1-aminophenazin-2-ol (PubChem CID 136672277) has the molecular formula C12H9N3O
and a molecular weight of 211.22 g/mol. Its IUPAC name is 1-aminophenazin-2-ol.
Molecular Properties
| Compound Name | 1-aminophenazin-2-ol |
| PubChem CID | 136672277 |
| Molecular Formula | C12H9N3O |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 1-aminophenazin-2-ol |
| SMILES | Nc1c(O)ccc2nc3ccccc3nc12 |
| InChI | InChI=1S/C12H9N3O/c13-11-10(16)6-5-9-12(11)15-8-4-2-1-3-7(8)14-9/h1-6,16H,13H2 |
| InChIKey | FYRXXLZLWKEZER-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1-aminophenazin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminophenazin-2-ol?
The IUPAC name of 1-aminophenazin-2-ol (CID 136672277) is 1-aminophenazin-2-ol.
What is the SMILES notation for 1-aminophenazin-2-ol?
The canonical SMILES for 1-aminophenazin-2-ol is Nc1c(O)ccc2nc3ccccc3nc12.
What is the InChIKey of 1-aminophenazin-2-ol?
The InChIKey is FYRXXLZLWKEZER-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3O/c13-11-10(16)6-5-9-12(11)15-8-4-2-1-3-7(8)14-9/h1-6,16H,13H2.
What are the key properties of 1-aminophenazin-2-ol?
1-aminophenazin-2-ol has a molecular weight of 211.22 g/mol, XLogP of 2.07, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminophenazin-2-ol is sourced from PubChem (CID 136672277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).