C9H10ClNO — CID 146287035
6-(1-chloroethyl)-2,3-dihydrofuro[2,3-b]pyridine (PubChem CID 146287035) has the molecular formula C9H10ClNO and a molecular weight of 183.64 g/mol. Its IUPAC name is 6-(1-chloroethyl)-2,3-dihydrofuro[2,3-b]pyridine.
| Compound Name | 6-(1-chloroethyl)-2,3-dihydrofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 146287035 |
| Molecular Formula | C9H10ClNO |
| Molecular Weight | 183.64 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 6-(1-chloroethyl)-2,3-dihydrofuro[2,3-b]pyridine |
| SMILES | CC(Cl)c1ccc2c(n1)OCC2 |
| InChI | InChI=1S/C9H10ClNO/c1-6(10)8-3-2-7-4-5-12-9(7)11-8/h2-3,6H,4-5H2,1H3 |
| InChIKey | GTQLBBISDJKKQC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.64 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|