C9H10ClNO2 — CID 146283740
7-(1-chloroethyl)-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine (PubChem CID 146283740) has the molecular formula C9H10ClNO2 and a molecular weight of 199.64 g/mol. Its IUPAC name is 7-(1-chloroethyl)-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine.
| Compound Name | 7-(1-chloroethyl)-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine |
|---|---|
| PubChem CID | 146283740 |
| Molecular Formula | C9H10ClNO2 |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | 7-(1-chloroethyl)-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine |
| SMILES | CC(Cl)c1cnc2c(c1)OCCO2 |
| InChI | InChI=1S/C9H10ClNO2/c1-6(10)7-4-8-9(11-5-7)13-3-2-12-8/h4-6H,2-3H2,1H3 |
| InChIKey | ITJIZYQAKQBQCM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|