C8H8N2O3 — CID 144727603
2,3-dihydro-[1,4]dioxino[2,3-b]pyridine-7-carboxamide (PubChem CID 144727603) has the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. Its IUPAC name is 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine-7-carboxamide.
| Compound Name | 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 144727603 |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine-7-carboxamide |
| SMILES | NC(=O)c1cnc2c(c1)OCCO2 |
| InChI | InChI=1S/C8H8N2O3/c9-7(11)5-3-6-8(10-4-5)13-2-1-12-6/h3-4H,1-2H2,(H2,9,11) |
| InChIKey | HFFWXRVWNUSLDH-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |