C11H12 — CID 166793534
1,2,3-trimethylpentalene (PubChem CID 166793534) has the molecular formula C11H12 and a molecular weight of 144.22 g/mol. Its IUPAC name is 1,2,3-trimethylpentalene.
| Compound Name | 1,2,3-trimethylpentalene |
|---|---|
| PubChem CID | 166793534 |
| Molecular Formula | C11H12 |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | 1,2,3-trimethylpentalene |
| SMILES | CC1=C(C)C(C)=C2C=CC=C12 |
| InChI | InChI=1S/C11H12/c1-7-8(2)10-5-4-6-11(10)9(7)3/h4-6H,1-3H3 |
| InChIKey | CPBZUYDRCPKUGU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |