C12H16 — CID 173070981
(3Z,5Z)-1,2,3,4-tetramethylcycloocta-1,3,5,7-tetraene (PubChem CID 173070981) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is (3Z,5Z)-1,2,3,4-tetramethylcycloocta-1,3,5,7-tetraene.
| Compound Name | (3Z,5Z)-1,2,3,4-tetramethylcycloocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 173070981 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | (3Z,5Z)-1,2,3,4-tetramethylcycloocta-1,3,5,7-tetraene |
| SMILES | CC1=C(C)/C(C)=C(C)\C=C/C=C1 |
| InChI | InChI=1S/C12H16/c1-9-7-5-6-8-10(2)12(4)11(9)3/h5-8H,1-4H3/b6-5?,7-5-,8-6?,9-7-,10-8?,11-9-,12-10?,12-11? |
| InChIKey | RJSBVCBNRZPVHP-GVFPRZTJSA-N |
| XLogP | 3.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |