About 10-methylbicyclo[4.3.1]deca-1(10),2,4,6,8-pentaene
10-methylbicyclo[4.3.1]deca-1(10),2,4,6,8-pentaene (PubChem CID 163536281) has the molecular formula C11H10
and a molecular weight of 142.20 g/mol. Its IUPAC name is 10-methylbicyclo[4.3.1]deca-1(10),2,4,6,8-pentaene.
Analyze 10-methylbicyclo[4.3.1]deca-1(10),2,4,6,8-pentaene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methylbicyclo[4.3.1]deca-1(10),2,4,6,8-pentaene?
The IUPAC name of 10-methylbicyclo[4.3.1]deca-1(10),2,4,6,8-pentaene (CID 163536281) is 10-methylbicyclo[4.3.1]deca-1(10),2,4,6,8-pentaene.
What is the SMILES notation for 10-methylbicyclo[4.3.1]deca-1(10),2,4,6,8-pentaene?
The canonical SMILES for 10-methylbicyclo[4.3.1]deca-1(10),2,4,6,8-pentaene is Cc1c2cccc1C=CC=C2.
What is the InChIKey of 10-methylbicyclo[4.3.1]deca-1(10),2,4,6,8-pentaene?
The InChIKey is DXFXFGWVPKOKPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10/c1-9-10-5-2-3-6-11(9)8-4-7-10/h2-8H,1H3.
What are the key properties of 10-methylbicyclo[4.3.1]deca-1(10),2,4,6,8-pentaene?
10-methylbicyclo[4.3.1]deca-1(10),2,4,6,8-pentaene has a molecular weight of 142.20 g/mol, XLogP of 3.04, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methylbicyclo[4.3.1]deca-1(10),2,4,6,8-pentaene is sourced from PubChem (CID 163536281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).