C8H6O2 — CID 175582324
pentalene-1,3-diol (PubChem CID 175582324) has the molecular formula C8H6O2 and a molecular weight of 134.13 g/mol. Its IUPAC name is pentalene-1,3-diol.
| Compound Name | pentalene-1,3-diol |
|---|---|
| PubChem CID | 175582324 |
| Molecular Formula | C8H6O2 |
| Molecular Weight | 134.13 g/mol |
| Exact Mass | 134.04 |
| IUPAC Name | pentalene-1,3-diol |
| SMILES | OC1=CC(O)=C2C=CC=C12 |
| InChI | InChI=1S/C8H6O2/c9-7-4-8(10)6-3-1-2-5(6)7/h1-4,9-10H |
| InChIKey | NONNQSNUYPREDC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.13 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |