About tricyclo[6.2.1.02,6]undeca-1,3,5,8(11),9-pentaene
tricyclo[6.2.1.02,6]undeca-1,3,5,8(11),9-pentaene (PubChem CID 143781348) has the molecular formula C11H8
and a molecular weight of 140.18 g/mol. Its IUPAC name is tricyclo[6.2.1.02,6]undeca-1,3,5,8(11),9-pentaene.
Analyze tricyclo[6.2.1.02,6]undeca-1,3,5,8(11),9-pentaene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[6.2.1.02,6]undeca-1,3,5,8(11),9-pentaene?
The IUPAC name of tricyclo[6.2.1.02,6]undeca-1,3,5,8(11),9-pentaene (CID 143781348) is tricyclo[6.2.1.02,6]undeca-1,3,5,8(11),9-pentaene.
What is the SMILES notation for tricyclo[6.2.1.02,6]undeca-1,3,5,8(11),9-pentaene?
The canonical SMILES for tricyclo[6.2.1.02,6]undeca-1,3,5,8(11),9-pentaene is C1=CC2=C3C=CC(=C3)CC2=C1.
What is the InChIKey of tricyclo[6.2.1.02,6]undeca-1,3,5,8(11),9-pentaene?
The InChIKey is XVQCEHDNVQOXSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8/c1-2-9-6-8-4-5-10(7-8)11(9)3-1/h1-5,7H,6H2.
What are the key properties of tricyclo[6.2.1.02,6]undeca-1,3,5,8(11),9-pentaene?
tricyclo[6.2.1.02,6]undeca-1,3,5,8(11),9-pentaene has a molecular weight of 140.18 g/mol, XLogP of 2.68, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[6.2.1.02,6]undeca-1,3,5,8(11),9-pentaene is sourced from PubChem (CID 143781348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).