C24H18 — CID 101378249
hexacyclo[15.4.1.12,5.16,11.03,15.04,13]tetracosa-1(21),2,4,6,8,10,12,15,17,19-decaene (PubChem CID 101378249) has the molecular formula C24H18 and a molecular weight of 306.41 g/mol. Its IUPAC name is hexacyclo[15.4.1.12,5.16,11.03,15.04,13]tetracosa-1(21),2,4,6,8,10,12,15,17,19-decaene.
| Compound Name | hexacyclo[15.4.1.12,5.16,11.03,15.04,13]tetracosa-1(21),2,4,6,8,10,12,15,17,19-decaene |
|---|---|
| PubChem CID | 101378249 |
| Molecular Formula | C24H18 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | hexacyclo[15.4.1.12,5.16,11.03,15.04,13]tetracosa-1(21),2,4,6,8,10,12,15,17,19-decaene |
| SMILES | C1=CC=C2CC(=C1)C=C1CC3=CC4=CC=CC=C(C4)C4=C3C1=C2C4 |
| InChI | InChI=1S/C24H18/c1-3-7-17-9-15(5-1)11-19-13-20-12-16-6-2-4-8-18(10-16)22-14-21(17)23(19)24(20)22/h1-8,11-12H,9-10,13-14H2 |
| InChIKey | DKKAYQIJBBTVNA-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |